C26H38O9 — CID 10577145
[(1S,2R,3R,4S,6R,7S,9R,10S,11S,13S,15R)-2,6-diacetyloxy-3,7,15-trihydroxy-5,5,9-trimethyl-14-methylidene-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 10577145) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is [(1S,2R,3R,4S,6R,7S,9R,10S,11S,13S,15R)-2,6-diacetyloxy-3,7,15-trihydroxy-5,5,9-trimethyl-14-methylidene-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1S,2R,3R,4S,6R,7S,9R,10S,11S,13S,15R)-2,6-diacetyloxy-3,7,15-trihydroxy-5,5,9-trimethyl-14-methylidene-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 10577145 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(1S,2R,3R,4S,6R,7S,9R,10S,11S,13S,15R)-2,6-diacetyloxy-3,7,15-trihydroxy-5,5,9-trimethyl-14-methylidene-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | C=C1[C@@H]2C[C@H](OC(C)=O)[C@H]3[C@]4(C)C[C@H](O)[C@H](OC(C)=O)C(C)(C)[C@H]4[C@@H](O)[C@H](OC(C)=O)[C@]3(C2)[C@@H]1O |
| InChI | InChI=1S/C26H38O9/c1-11-15-8-17(33-12(2)27)19-25(7)10-16(30)22(34-13(3)28)24(5,6)20(25)18(31)23(35-14(4)29)26(19,9-15)21(11)32/h15-23,30-32H,1,8-10H2,2-7H3/t15-,16+,17+,18-,19+,20-,21-,22+,23+,25+,26+/m1/s1 |
| InChIKey | ZWOHEZHBBSKLMQ-QSQMGKGMSA-N |
| XLogP | 1.51 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|