C22H34O3 — CID 162968854
[(1R,4S,9R,10S,11R,13S,15R)-11-hydroxy-5,5,9-trimethyl-14-methylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 162968854) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1R,4S,9R,10S,11R,13S,15R)-11-hydroxy-5,5,9-trimethyl-14-methylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1R,4S,9R,10S,11R,13S,15R)-11-hydroxy-5,5,9-trimethyl-14-methylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 162968854 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1R,4S,9R,10S,11R,13S,15R)-11-hydroxy-5,5,9-trimethyl-14-methylidene-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | C=C1[C@@H]2C[C@@H](O)[C@H]3[C@]4(C)CCCC(C)(C)[C@@H]4CC[C@]3(C2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O3/c1-13-15-11-16(24)18-21(5)9-6-8-20(3,4)17(21)7-10-22(18,12-15)19(13)25-14(2)23/h15-19,24H,1,6-12H2,2-5H3/t15-,16-,17+,18+,19-,21-,22-/m1/s1 |
| InChIKey | QKPODPHHYPOPHY-DNUTWTKLSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|