C24H34O8 — CID 102413772
[(1R,2R,3R,4R,6S,9S,10S,13R,14R,15R,16S)-15-acetyloxy-6,10,14-trihydroxy-13,16,17,17-tetramethyl-7-oxahexacyclo[7.6.1.11,4.02,9.02,13.06,16]heptadecan-3-yl] acetate (PubChem CID 102413772) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1R,2R,3R,4R,6S,9S,10S,13R,14R,15R,16S)-15-acetyloxy-6,10,14-trihydroxy-13,16,17,17-tetramethyl-7-oxahexacyclo[7.6.1.11,4.02,9.02,13.06,16]heptadecan-3-yl] acetate.
| Compound Name | [(1R,2R,3R,4R,6S,9S,10S,13R,14R,15R,16S)-15-acetyloxy-6,10,14-trihydroxy-13,16,17,17-tetramethyl-7-oxahexacyclo[7.6.1.11,4.02,9.02,13.06,16]heptadecan-3-yl] acetate |
|---|---|
| PubChem CID | 102413772 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1R,2R,3R,4R,6S,9S,10S,13R,14R,15R,16S)-15-acetyloxy-6,10,14-trihydroxy-13,16,17,17-tetramethyl-7-oxahexacyclo[7.6.1.11,4.02,9.02,13.06,16]heptadecan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2C[C@]3(O)OC[C@@]45[C@@H](O)CC[C@@]6(C)[C@@H](O)[C@H](OC(C)=O)[C@@](C2(C)C)([C@@]43C)[C@@]156 |
| InChI | InChI=1S/C24H34O8/c1-11(25)31-16-13-9-22(29)20(6)21(10-30-22)14(27)7-8-19(5)15(28)17(32-12(2)26)23(20,18(13,3)4)24(16,19)21/h13-17,27-29H,7-10H2,1-6H3/t13-,14-,15-,16+,17-,19-,20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | NGMFMMAWUVIFEZ-JIOZTJFASA-N |
| XLogP | 1.14 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |