C15H26O4 — CID 134857254
[(2S,4aR,8R,8aR)-8,8a-dihydroxy-4a,5,6-trimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate (PubChem CID 134857254) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(2S,4aR,8R,8aR)-8,8a-dihydroxy-4a,5,6-trimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate.
| Compound Name | [(2S,4aR,8R,8aR)-8,8a-dihydroxy-4a,5,6-trimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 134857254 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(2S,4aR,8R,8aR)-8,8a-dihydroxy-4a,5,6-trimethyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C(C)C(C)C[C@@H](O)[C@@]2(O)C1 |
| InChI | InChI=1S/C15H26O4/c1-9-7-13(17)15(18)8-12(19-11(3)16)5-6-14(15,4)10(9)2/h9-10,12-13,17-18H,5-8H2,1-4H3/t9?,10?,12-,13+,14+,15-/m0/s1 |
| InChIKey | OXAOXRURFQGTOR-WPWGVLKJSA-N |
| XLogP | 1.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |