C27H42O5 — CID 17388611
[(13aR)-6b-acetyl-13,13a-dihydroxy-4a,6a-dimethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl] acetate (PubChem CID 17388611) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is [(13aR)-6b-acetyl-13,13a-dihydroxy-4a,6a-dimethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl] acetate.
| Compound Name | [(13aR)-6b-acetyl-13,13a-dihydroxy-4a,6a-dimethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 17388611 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [(13aR)-6b-acetyl-13,13a-dihydroxy-4a,6a-dimethyl-2,3,4,4b,5,6,7,8,9,10,10a,11,11a,11b,12,13-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C3CCC4(C)C(CC5CCCCC54C(C)=O)C3CC(O)[C@@]2(O)C1 |
| InChI | InChI=1S/C27H42O5/c1-16(28)26-10-6-5-7-18(26)13-22-20-14-23(30)27(31)15-19(32-17(2)29)8-11-25(27,4)21(20)9-12-24(22,26)3/h18-23,30-31H,5-15H2,1-4H3/t18?,19?,20?,21?,22?,23?,24?,25?,26?,27-/m0/s1 |
| InChIKey | JLLVFVFTAIZCDN-KKBCKPMXSA-N |
| XLogP | 4.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |