C24H34O8 — CID 101346114
[(1S,2R,3R,4R,7S,8R,10S,11R,13R,15S)-9-acetyloxy-3,7,11-trihydroxy-4,10,16,16-tetramethyl-17-oxahexacyclo[11.2.1.18,11.01,10.04,15.08,15]heptadecan-2-yl] acetate (PubChem CID 101346114) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1S,2R,3R,4R,7S,8R,10S,11R,13R,15S)-9-acetyloxy-3,7,11-trihydroxy-4,10,16,16-tetramethyl-17-oxahexacyclo[11.2.1.18,11.01,10.04,15.08,15]heptadecan-2-yl] acetate.
| Compound Name | [(1S,2R,3R,4R,7S,8R,10S,11R,13R,15S)-9-acetyloxy-3,7,11-trihydroxy-4,10,16,16-tetramethyl-17-oxahexacyclo[11.2.1.18,11.01,10.04,15.08,15]heptadecan-2-yl] acetate |
|---|---|
| PubChem CID | 101346114 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1S,2R,3R,4R,7S,8R,10S,11R,13R,15S)-9-acetyloxy-3,7,11-trihydroxy-4,10,16,16-tetramethyl-17-oxahexacyclo[11.2.1.18,11.01,10.04,15.08,15]heptadecan-2-yl] acetate |
| SMILES | CC(=O)OC1[C@]2(C)[C@@]34[C@@H](OC(C)=O)[C@H](O)[C@]5(C)CC[C@H](O)[C@@]16O[C@]2(O)C[C@@H](C[C@@]356)C4(C)C |
| InChI | InChI=1S/C24H34O8/c1-11(25)30-16-15(28)19(5)8-7-14(27)23-17(31-12(2)26)20(6)22(29,32-23)10-13-9-21(19,23)24(16,20)18(13,3)4/h13-17,27-29H,7-10H2,1-6H3/t13-,14+,15+,16+,17?,19+,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | DPOMLAXYSNBCCB-HIALQQFZSA-N |
| XLogP | 1.29 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |