C19H30O4 — CID 142122560
[(1R,4R,6R,9R)-4-ethoxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methyl acetate (PubChem CID 142122560) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(1R,4R,6R,9R)-4-ethoxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methyl acetate.
| Compound Name | [(1R,4R,6R,9R)-4-ethoxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methyl acetate |
|---|---|
| PubChem CID | 142122560 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [(1R,4R,6R,9R)-4-ethoxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methyl acetate |
| SMILES | CCO[C@H]1C=C(COC(C)=O)[C@@]23C[C@@H](CC[C@]2(C)C1)C(C)(C)O3 |
| InChI | InChI=1S/C19H30O4/c1-6-21-16-9-15(12-22-13(2)20)19-10-14(17(3,4)23-19)7-8-18(19,5)11-16/h9,14,16H,6-8,10-12H2,1-5H3/t14-,16+,18-,19+/m1/s1 |
| InChIKey | MHANPIMPKKQVJG-HYEGPXJVSA-N |
| XLogP | 3.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|