C28H40O11 — CID 10187584
[(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-[[(6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methoxy]oxan-4-yl] acetate (PubChem CID 10187584) has the molecular formula C28H40O11 and a molecular weight of 552.62 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-[[(6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methoxy]oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-[[(6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 10187584 |
| Molecular Formula | C28H40O11 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-2,3,5-triacetyloxy-6-[[(6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methoxy]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](OCC2=CCC[C@@]3(C)CC[C@@H]4CC23OC4(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H40O11/c1-15(29)34-21-22(35-16(2)30)24(38-25(37-18(4)32)23(21)36-17(3)31)33-14-20-9-8-11-27(7)12-10-19-13-28(20,27)39-26(19,5)6/h9,19,21-25H,8,10-14H2,1-7H3/t19-,21-,22-,23+,24-,25+,27+,28?/m1/s1 |
| InChIKey | SAVBOKDSAPZWFW-VGBIATQQSA-N |
| XLogP | 3.12 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|