C33H46O16 — CID 10556638
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]oxan-2-yl]methoxy]oxan-3-yl] acetate (PubChem CID 10556638) has the molecular formula C33H46O16 and a molecular weight of 698.71 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]oxan-2-yl]methoxy]oxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]oxan-2-yl]methoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10556638 |
| Molecular Formula | C33H46O16 |
| Molecular Weight | 698.71 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]oxan-2-yl]methoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCC2=CC[C@H]3C[C@@H]2C3(C)C)O[C@H](CO[C@@H]2OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H46O16/c1-15(34)43-24-13-41-31(29(47-19(5)38)27(24)45-17(3)36)42-14-25-26(44-16(2)35)28(46-18(4)37)30(48-20(6)39)32(49-25)40-12-21-9-10-22-11-23(21)33(22,7)8/h9,22-32H,10-14H2,1-8H3/t22-,23-,24-,25+,26+,27-,28-,29+,30+,31-,32+/m0/s1 |
| InChIKey | ZHOLAMFVYRAVHA-DUUZSZOESA-N |
| XLogP | 1.68 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|