C32H36O18 — CID 11072558
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxan-2-yl]methoxy]oxan-3-yl] acetate (PubChem CID 11072558) has the molecular formula C32H36O18 and a molecular weight of 708.62 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxan-2-yl]methoxy]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxan-2-yl]methoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11072558 |
| Molecular Formula | C32H36O18 |
| Molecular Weight | 708.62 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxan-2-yl]methoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Oc2ccc3ccc(=O)oc3c2)O[C@H](CO[C@@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H36O18/c1-14(33)42-23-12-40-31(29(46-18(5)37)27(23)44-16(3)35)41-13-24-26(43-15(2)34)28(45-17(4)36)30(47-19(6)38)32(50-24)48-21-9-7-20-8-10-25(39)49-22(20)11-21/h7-11,23-24,26-32H,12-13H2,1-6H3/t23-,24-,26-,27+,28+,29-,30-,31+,32-/m1/s1 |
| InChIKey | WWGRSIJCRGQKOU-GAPKNSBLSA-N |
| XLogP | 0.86 |
| TPSA | 224.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.62 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|