C13H22INO8 — CID 156904565
2-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxyethylazanium iodide (PubChem CID 156904565) has the molecular formula C13H22INO8 and a molecular weight of 447.22 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxyethylazanium iodide.
| Compound Name | 2-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxyethylazanium iodide |
|---|---|
| PubChem CID | 156904565 |
| Molecular Formula | C13H22INO8 |
| Molecular Weight | 447.22 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxyethylazanium iodide |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OCC[NH3+])OC[C@@H]1OC(C)=O.[I-] |
| InChI | InChI=1S/C13H21NO8.HI/c1-7(15)20-10-6-19-13(18-5-4-14)12(22-9(3)17)11(10)21-8(2)16;/h10-13H,4-6,14H2,1-3H3;1H/t10-,11-,12+,13-;/m0./s1 |
| InChIKey | MLOWCMXPLZUEKT-XIFPHAGOSA-N |
| XLogP | -4.60 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.22 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|