C18H30O4 — CID 163640633
(1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-3,4,4-triol (PubChem CID 163640633) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-3,4,4-triol.
| Compound Name | (1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-3,4,4-triol |
|---|---|
| PubChem CID | 163640633 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-3,4,4-triol |
| SMILES | CCCCC1=C(O)C(O)(O)C[C@@]2(C)CC[C@@H]3C[C@]12OC3(C)C |
| InChI | InChI=1S/C18H30O4/c1-5-6-7-13-14(19)18(20,21)11-16(4)9-8-12-10-17(13,16)22-15(12,2)3/h12,19-21H,5-11H2,1-4H3/t12-,16-,17+/m1/s1 |
| InChIKey | IDYNQIVDOZQNIQ-JLZZUVOBSA-N |
| XLogP | 3.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|