C18H28O3 — CID 102341577
(1R,6R,8S,9S)-2-butyl-8-hydroxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one (PubChem CID 102341577) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (1R,6R,8S,9S)-2-butyl-8-hydroxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one.
| Compound Name | (1R,6R,8S,9S)-2-butyl-8-hydroxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one |
|---|---|
| PubChem CID | 102341577 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (1R,6R,8S,9S)-2-butyl-8-hydroxy-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one |
| SMILES | CCCCC1=CC(=O)C[C@@]2(C)C[C@H](O)[C@@H]3C[C@]12OC3(C)C |
| InChI | InChI=1S/C18H28O3/c1-5-6-7-12-8-13(19)9-17(4)11-15(20)14-10-18(12,17)21-16(14,2)3/h8,14-15,20H,5-7,9-11H2,1-4H3/t14-,15-,17-,18-/m0/s1 |
| InChIKey | AXXNOPVISMEZLY-LAQRGFTBSA-N |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |