C40H66O3 — CID 161444307
2-[(2R,4aR)-8,8-dibutyl-4a-methyl-2,3,4,5-tetrahydronaphthalen-2-yl]propan-2-ol;(1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one (PubChem CID 161444307) has the molecular formula C40H66O3 and a molecular weight of 594.97 g/mol. Its IUPAC name is 2-[(2R,4aR)-8,8-dibutyl-4a-methyl-2,3,4,5-tetrahydronaphthalen-2-yl]propan-2-ol;(1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one.
| Compound Name | 2-[(2R,4aR)-8,8-dibutyl-4a-methyl-2,3,4,5-tetrahydronaphthalen-2-yl]propan-2-ol;(1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one |
|---|---|
| PubChem CID | 161444307 |
| Molecular Formula | C40H66O3 |
| Molecular Weight | 594.97 g/mol |
| Exact Mass | 594.50 |
| IUPAC Name | 2-[(2R,4aR)-8,8-dibutyl-4a-methyl-2,3,4,5-tetrahydronaphthalen-2-yl]propan-2-ol;(1R,6R,9R)-2-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-one |
| SMILES | CCCCC1(CCCC)C=CC[C@@]2(C)CC[C@@H](C(C)(C)O)C=C12.CCCCC1=CC(=O)C[C@@]2(C)CC[C@@H]3C[C@]12OC3(C)C |
| InChI | InChI=1S/C22H38O.C18H28O2/c1-6-8-13-22(14-9-7-2)15-10-12-21(5)16-11-18(17-19(21)22)20(3,4)23;1-5-6-7-13-10-15(19)12-17(4)9-8-14-11-18(13,17)20-16(14,2)3/h10,15,17-18,23H,6-9,11-14,16H2,1-5H3;10,14H,5-9,11-12H2,1-4H3/t18-,21+;14-,17-,18+/m11/s1 |
| InChIKey | VZRPAGZTEPAXEI-GASCDPJJSA-N |
| XLogP | 10.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.97 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|