C18H32O2 — CID 15513011
(1S,3S,6R,9R)-3-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol (PubChem CID 15513011) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (1S,3S,6R,9R)-3-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol.
| Compound Name | (1S,3S,6R,9R)-3-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol |
|---|---|
| PubChem CID | 15513011 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (1S,3S,6R,9R)-3-butyl-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol |
| SMILES | CCCC[C@]1(O)CC[C@@]2(C)CC[C@@H]3C[C@@]2(C1)OC3(C)C |
| InChI | InChI=1S/C18H32O2/c1-5-6-8-17(19)11-10-16(4)9-7-14-12-18(16,13-17)20-15(14,2)3/h14,19H,5-13H2,1-4H3/t14-,16-,17+,18+/m1/s1 |
| InChIKey | KFPPZJFZNNQYCZ-BGTYHANMSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |