About 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol
6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol (PubChem CID 72789838) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol.
Analyze 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol?
The IUPAC name of 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol (CID 72789838) is 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol.
What is the SMILES notation for 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol?
The canonical SMILES for 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol is CC1(C)OC23CC(O)CCC2(C)CCC1C3.
What is the InChIKey of 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol?
The InChIKey is JMNADGYKAXCEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-12(2)10-4-6-13(3)7-5-11(15)9-14(13,8-10)16-12/h10-11,15H,4-9H2,1-3H3.
What are the key properties of 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol?
6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol has a molecular weight of 224.34 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-3-ol is sourced from PubChem (CID 72789838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).