C17H30O2 — CID 59921249
3-[(1S,2R,6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-2-yl]propan-1-ol (PubChem CID 59921249) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 3-[(1S,2R,6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-2-yl]propan-1-ol.
| Compound Name | 3-[(1S,2R,6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 59921249 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 3-[(1S,2R,6S,9R)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-2-yl]propan-1-ol |
| SMILES | CC1(C)O[C@]23C[C@H]1CC[C@]2(C)CCC[C@@H]3CCCO |
| InChI | InChI=1S/C17H30O2/c1-15(2)14-8-10-16(3)9-4-6-13(7-5-11-18)17(16,12-14)19-15/h13-14,18H,4-12H2,1-3H3/t13-,14-,16+,17+/m1/s1 |
| InChIKey | DVPAMJKPNIOSKZ-JHNDHUHGSA-N |
| XLogP | 3.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |