About 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol
3-(3,3-dimethyldioxolan-4-yl)propan-1-ol (PubChem CID 87498556) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol |
| PubChem CID | 87498556 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol |
| SMILES | CC1(C)OOCC1CCCO |
| InChI | InChI=1S/C8H16O3/c1-8(2)7(4-3-5-9)6-10-11-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | OSCPJZHXVRTIBU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol?
The IUPAC name of 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol (CID 87498556) is 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol.
What is the SMILES notation for 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol?
The canonical SMILES for 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol is CC1(C)OOCC1CCCO.
What is the InChIKey of 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol?
The InChIKey is OSCPJZHXVRTIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-8(2)7(4-3-5-9)6-10-11-8/h7,9H,3-6H2,1-2H3.
What are the key properties of 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol?
3-(3,3-dimethyldioxolan-4-yl)propan-1-ol has a molecular weight of 160.21 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethyldioxolan-4-yl)propan-1-ol is sourced from PubChem (CID 87498556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).