About 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol
3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol (PubChem CID 129407915) has the molecular formula C6H10F2O
and a molecular weight of 136.14 g/mol. Its IUPAC name is 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol |
| PubChem CID | 129407915 |
| Molecular Formula | C6H10F2O |
| Molecular Weight | 136.14 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol |
| SMILES | OCCC[C@@H]1CC1(F)F |
| InChI | InChI=1S/C6H10F2O/c7-6(8)4-5(6)2-1-3-9/h5,9H,1-4H2/t5-/m1/s1 |
| InChIKey | SRIWUMJIBUJDFP-RXMQYKEDSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol?
The IUPAC name of 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol (CID 129407915) is 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol.
What is the SMILES notation for 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol?
The canonical SMILES for 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol is OCCC[C@@H]1CC1(F)F.
What is the InChIKey of 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol?
The InChIKey is SRIWUMJIBUJDFP-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10F2O/c7-6(8)4-5(6)2-1-3-9/h5,9H,1-4H2/t5-/m1/s1.
What are the key properties of 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol?
3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol has a molecular weight of 136.14 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-2,2-difluorocyclopropyl]propan-1-ol is sourced from PubChem (CID 129407915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).