About 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol
4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol (PubChem CID 166846996) has the molecular formula C12H22F2O4
and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol.
Molecular Properties
| Compound Name | 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol |
| PubChem CID | 166846996 |
| Molecular Formula | C12H22F2O4 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol |
| SMILES | OCCCCOC1CC(F)(F)C1OCCCCO |
| InChI | InChI=1S/C12H22F2O4/c13-12(14)9-10(17-7-3-1-5-15)11(12)18-8-4-2-6-16/h10-11,15-16H,1-9H2 |
| InChIKey | BRDJQRNIKNBVGD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol?
The IUPAC name of 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol (CID 166846996) is 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol.
What is the SMILES notation for 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol?
The canonical SMILES for 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol is OCCCCOC1CC(F)(F)C1OCCCCO.
What is the InChIKey of 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol?
The InChIKey is BRDJQRNIKNBVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2O4/c13-12(14)9-10(17-7-3-1-5-15)11(12)18-8-4-2-6-16/h10-11,15-16H,1-9H2.
What are the key properties of 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol?
4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol has a molecular weight of 268.30 g/mol, XLogP of 1.34, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,3-difluoro-2-(4-hydroxybutoxy)cyclobutyl]oxybutan-1-ol is sourced from PubChem (CID 166846996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).