C19H32O3 — CID 142113536
(4R,6R)-4-butyl-2-(hydroxymethyl)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-ol (PubChem CID 142113536) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (4R,6R)-4-butyl-2-(hydroxymethyl)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-ol.
| Compound Name | (4R,6R)-4-butyl-2-(hydroxymethyl)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-ol |
|---|---|
| PubChem CID | 142113536 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (4R,6R)-4-butyl-2-(hydroxymethyl)-6,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-4-ol |
| SMILES | CCCC[C@]1(O)C=C(CO)C23CC(CC[C@]2(C)C1)C(C)(C)O3 |
| InChI | InChI=1S/C19H32O3/c1-5-6-8-18(21)10-15(12-20)19-11-14(16(2,3)22-19)7-9-17(19,4)13-18/h10,14,20-21H,5-9,11-13H2,1-4H3/t14?,17-,18+,19?/m1/s1 |
| InChIKey | PFOHAXINNOSSCI-UGAWAQNWSA-N |
| XLogP | 3.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|