C19H32O — CID 15512991
(1R,6S,9R)-6,10,10-trimethyl-2-(3-methylbutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene (PubChem CID 15512991) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (1R,6S,9R)-6,10,10-trimethyl-2-(3-methylbutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene.
| Compound Name | (1R,6S,9R)-6,10,10-trimethyl-2-(3-methylbutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
|---|---|
| PubChem CID | 15512991 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (1R,6S,9R)-6,10,10-trimethyl-2-(3-methylbutyl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
| SMILES | CC(C)CCC1=CCC[C@@]2(C)CC[C@@H]3C[C@]12OC3(C)C |
| InChI | InChI=1S/C19H32O/c1-14(2)8-9-15-7-6-11-18(5)12-10-16-13-19(15,18)20-17(16,3)4/h7,14,16H,6,8-13H2,1-5H3/t16-,18+,19+/m1/s1 |
| InChIKey | TVCCIPIDKXCSEE-NEWSRXKRSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|