C18H28O2 — CID 142113467
[(6R)-6,10,10-trimethyl-4-prop-2-enyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methanol (PubChem CID 142113467) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [(6R)-6,10,10-trimethyl-4-prop-2-enyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methanol.
| Compound Name | [(6R)-6,10,10-trimethyl-4-prop-2-enyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methanol |
|---|---|
| PubChem CID | 142113467 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [(6R)-6,10,10-trimethyl-4-prop-2-enyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-2-yl]methanol |
| SMILES | C=CCC1C=C(CO)C23CC(CC[C@]2(C)C1)C(C)(C)O3 |
| InChI | InChI=1S/C18H28O2/c1-5-6-13-9-15(12-19)18-11-14(16(2,3)20-18)7-8-17(18,4)10-13/h5,9,13-14,19H,1,6-8,10-12H2,2-4H3/t13?,14?,17-,18?/m1/s1 |
| InChIKey | NWPMNTQCMJRNPQ-SEEMLRNQSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|