C17H22O5 — CID 15517958
[(1S,5R,6R,9S)-2,6,10,10-tetramethyl-4,7-dioxo-11-oxatricyclo[7.2.1.01,6]dodec-2-en-5-yl] acetate (PubChem CID 15517958) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(1S,5R,6R,9S)-2,6,10,10-tetramethyl-4,7-dioxo-11-oxatricyclo[7.2.1.01,6]dodec-2-en-5-yl] acetate.
| Compound Name | [(1S,5R,6R,9S)-2,6,10,10-tetramethyl-4,7-dioxo-11-oxatricyclo[7.2.1.01,6]dodec-2-en-5-yl] acetate |
|---|---|
| PubChem CID | 15517958 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [(1S,5R,6R,9S)-2,6,10,10-tetramethyl-4,7-dioxo-11-oxatricyclo[7.2.1.01,6]dodec-2-en-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)C=C(C)[C@@]23C[C@@H](CC(=O)[C@]12C)C(C)(C)O3 |
| InChI | InChI=1S/C17H22O5/c1-9-6-12(19)14(21-10(2)18)16(5)13(20)7-11-8-17(9,16)22-15(11,3)4/h6,11,14H,7-8H2,1-5H3/t11-,14+,16-,17+/m1/s1 |
| InChIKey | FLWBYWJQSISHHE-HWHUXHBOSA-N |
| XLogP | 1.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |