C24H30O6 — CID 23255277
[(1S,4S,5S,6R,7S,9R)-5-acetyloxy-4-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-7-yl] benzoate (PubChem CID 23255277) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is [(1S,4S,5S,6R,7S,9R)-5-acetyloxy-4-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-7-yl] benzoate.
| Compound Name | [(1S,4S,5S,6R,7S,9R)-5-acetyloxy-4-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-7-yl] benzoate |
|---|---|
| PubChem CID | 23255277 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(1S,4S,5S,6R,7S,9R)-5-acetyloxy-4-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-en-7-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)C=C(C)[C@@]23C[C@@H](C[C@H](OC(=O)c4ccccc4)[C@]12C)C(C)(C)O3 |
| InChI | InChI=1S/C24H30O6/c1-14-11-18(26)20(28-15(2)25)23(5)19(29-21(27)16-9-7-6-8-10-16)12-17-13-24(14,23)30-22(17,3)4/h6-11,17-20,26H,12-13H2,1-5H3/t17-,18+,19+,20-,23-,24+/m1/s1 |
| InChIKey | ZDYCLGLQGIPKNT-OQIHLKNFSA-N |
| XLogP | 3.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|