About [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate
[(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate (PubChem CID 11298521) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate.
Analyze [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate?
The IUPAC name of [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate (CID 11298521) is [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate.
What is the SMILES notation for [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate?
The canonical SMILES for [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate is CC(=O)O[C@H]1C[C@H]2CC[C@]1(C)C(=O)C2.
What is the InChIKey of [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate?
The InChIKey is VCWQPRBJPSQDNT-INTQDDNPSA-N. The full InChI is InChI=1S/C11H16O3/c1-7(12)14-10-6-8-3-4-11(10,2)9(13)5-8/h8,10H,3-6H2,1-2H3/t8-,10-,11+/m0/s1.
What are the key properties of [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate?
[(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate has a molecular weight of 196.25 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,4R)-1-methyl-6-oxo-2-bicyclo[2.2.2]octanyl] acetate is sourced from PubChem (CID 11298521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).