C17H24O4 — CID 163017604
[(1S,3S,4R,8aS)-4-hydroxy-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate (PubChem CID 163017604) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(1S,3S,4R,8aS)-4-hydroxy-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate.
| Compound Name | [(1S,3S,4R,8aS)-4-hydroxy-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 163017604 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(1S,3S,4R,8aS)-4-hydroxy-5,8a-dimethyl-6-oxo-3-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] acetate |
| SMILES | C=C(C)[C@@H]1C[C@H](OC(C)=O)[C@@]2(C)CCC(=O)C(C)=C2[C@@H]1O |
| InChI | InChI=1S/C17H24O4/c1-9(2)12-8-14(21-11(4)18)17(5)7-6-13(19)10(3)15(17)16(12)20/h12,14,16,20H,1,6-8H2,2-5H3/t12-,14-,16+,17+/m0/s1 |
| InChIKey | AGTHQEDXWCIEBY-GUDXXQAFSA-N |
| XLogP | 2.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|