C22H32O7 — CID 78201088
(2,5,7,9-tetrahydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate (PubChem CID 78201088) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is (2,5,7,9-tetrahydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate.
| Compound Name | (2,5,7,9-tetrahydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate |
|---|---|
| PubChem CID | 78201088 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2,5,7,9-tetrahydroxy-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate |
| SMILES | C=C1C(O)CC(O)C2(C)C(O)C(OC(C)=O)C3=C(C)C(=O)CC(C(O)C12)C3(C)C |
| InChI | InChI=1S/C22H32O7/c1-9-14(25)8-15(26)22(6)16(9)18(27)12-7-13(24)10(2)17(21(12,4)5)19(20(22)28)29-11(3)23/h12,14-16,18-20,25-28H,1,7-8H2,2-6H3 |
| InChIKey | FNQIPMBDHMNBAB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|