C28H40O9 — CID 78146447
(2,9,10-triacetyloxy-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate (PubChem CID 78146447) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is (2,9,10-triacetyloxy-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate.
| Compound Name | (2,9,10-triacetyloxy-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate |
|---|---|
| PubChem CID | 78146447 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (2,9,10-triacetyloxy-5-hydroxy-8,12,15,15-tetramethyl-4-methylidene-13-tricyclo[9.3.1.03,8]pentadec-11-enyl) acetate |
| SMILES | C=C1C(O)CCC2(C)C(OC(C)=O)C(OC(C)=O)C3=C(C)C(OC(C)=O)CC(C(OC(C)=O)C12)C3(C)C |
| InChI | InChI=1S/C28H40O9/c1-13-20(33)10-11-28(9)23(13)24(35-16(4)30)19-12-21(34-15(3)29)14(2)22(27(19,7)8)25(36-17(5)31)26(28)37-18(6)32/h19-21,23-26,33H,1,10-12H2,2-9H3 |
| InChIKey | UVSUZWKQQLMVQV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|