C44H50O10 — CID 75013033
[2,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-13-(3-phenylprop-2-enoyloxy)-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 3-phenylprop-2-enoate (PubChem CID 75013033) has the molecular formula C44H50O10 and a molecular weight of 738.87 g/mol. Its IUPAC name is [2,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-13-(3-phenylprop-2-enoyloxy)-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 3-phenylprop-2-enoate.
| Compound Name | [2,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-13-(3-phenylprop-2-enoyloxy)-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 75013033 |
| Molecular Formula | C44H50O10 |
| Molecular Weight | 738.87 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | [2,9,10-triacetyloxy-8,12,15,15-tetramethyl-4-methylidene-13-(3-phenylprop-2-enoyloxy)-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 3-phenylprop-2-enoate |
| SMILES | C=C1C(OC(=O)C=Cc2ccccc2)CCC2(C)C(OC(C)=O)C(OC(C)=O)C3=C(C)C(OC(=O)C=Cc4ccccc4)CC(C(OC(C)=O)C12)C3(C)C |
| InChI | InChI=1S/C44H50O10/c1-26-34(53-36(48)21-19-31-15-11-9-12-16-31)23-24-44(8)39(26)40(50-28(3)45)33-25-35(54-37(49)22-20-32-17-13-10-14-18-32)27(2)38(43(33,6)7)41(51-29(4)46)42(44)52-30(5)47/h9-22,33-35,39-42H,1,23-25H2,2-8H3 |
| InChIKey | NEONKXWOPFGSRC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.87 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|