C35H44O9 — CID 162904302
[(2S,4R,5R,5aR,8S,10aS)-2,4,5-triacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-8-yl] 3-phenylprop-2-enoate (PubChem CID 162904302) has the molecular formula C35H44O9 and a molecular weight of 608.73 g/mol. Its IUPAC name is [(2S,4R,5R,5aR,8S,10aS)-2,4,5-triacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-8-yl] 3-phenylprop-2-enoate.
| Compound Name | [(2S,4R,5R,5aR,8S,10aS)-2,4,5-triacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-8-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162904302 |
| Molecular Formula | C35H44O9 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | [(2S,4R,5R,5aR,8S,10aS)-2,4,5-triacetyloxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-8-yl] 3-phenylprop-2-enoate |
| SMILES | C=C1C2C[C@]3(C(C)(C)O)C[C@H](OC(C)=O)C(C)=C3[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]2(C)CC[C@@H]1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C35H44O9/c1-20-26-18-35(33(6,7)40)19-28(41-22(3)36)21(2)30(35)31(42-23(4)37)32(43-24(5)38)34(26,8)17-16-27(20)44-29(39)15-14-25-12-10-9-11-13-25/h9-15,26-28,31-32,40H,1,16-19H2,2-8H3/t26?,27-,28-,31+,32-,34+,35-/m0/s1 |
| InChIKey | ZKCFVSFRWFBJHA-RNQOLAKJSA-N |
| XLogP | 5.26 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|