C33H42O10 — CID 102146273
[(5aS,9aR,10aR)-2,4,6-triacetyloxy-8-hydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate (PubChem CID 102146273) has the molecular formula C33H42O10 and a molecular weight of 598.69 g/mol. Its IUPAC name is [(5aS,9aR,10aR)-2,4,6-triacetyloxy-8-hydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate.
| Compound Name | [(5aS,9aR,10aR)-2,4,6-triacetyloxy-8-hydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate |
|---|---|
| PubChem CID | 102146273 |
| Molecular Formula | C33H42O10 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | [(5aS,9aR,10aR)-2,4,6-triacetyloxy-8-hydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate |
| SMILES | C=C1C(O)CC(OC(C)=O)[C@@]2(C)C(OC(=O)c3ccccc3)C(OC(C)=O)C3=C(C)C(OC(C)=O)C[C@]3(C(C)(C)O)C[C@H]12 |
| InChI | InChI=1S/C33H42O10/c1-17-23-15-33(31(6,7)39)16-25(40-19(3)34)18(2)27(33)28(42-21(5)36)29(43-30(38)22-12-10-9-11-13-22)32(23,8)26(14-24(17)37)41-20(4)35/h9-13,23-26,28-29,37,39H,1,14-16H2,2-8H3/t23-,24?,25?,26?,28?,29?,32+,33-/m1/s1 |
| InChIKey | LZZPXCROKNXNLF-MRHIWZSPSA-N |
| XLogP | 3.83 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|