C33H42O11 — CID 78384645
[2,6,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate (PubChem CID 78384645) has the molecular formula C33H42O11 and a molecular weight of 614.69 g/mol. Its IUPAC name is [2,6,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate.
| Compound Name | [2,6,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate |
|---|---|
| PubChem CID | 78384645 |
| Molecular Formula | C33H42O11 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | [2,6,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[g]azulen-5-yl] benzoate |
| SMILES | C=C1C(O)CC(OC(C)=O)C2(C)C(OC(=O)c3ccccc3)C(O)C3=C(C)C(OC(C)=O)CC3(C(C)(C)O)C(OC(C)=O)C12 |
| InChI | InChI=1S/C33H42O11/c1-16-22(37)14-24(42-19(4)35)32(8)26(16)28(43-20(5)36)33(31(6,7)40)15-23(41-18(3)34)17(2)25(33)27(38)29(32)44-30(39)21-12-10-9-11-13-21/h9-13,22-24,26-29,37-38,40H,1,14-15H2,2-8H3 |
| InChIKey | YWYQRZNXOIULGT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|