C28H40O11 — CID 162982511
[(2S,4R,5R,5aR,6R,8R,9aR,10S,10aS)-2,5,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-6-yl] acetate (PubChem CID 162982511) has the molecular formula C28H40O11 and a molecular weight of 552.62 g/mol. Its IUPAC name is [(2S,4R,5R,5aR,6R,8R,9aR,10S,10aS)-2,5,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-6-yl] acetate.
| Compound Name | [(2S,4R,5R,5aR,6R,8R,9aR,10S,10aS)-2,5,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-6-yl] acetate |
|---|---|
| PubChem CID | 162982511 |
| Molecular Formula | C28H40O11 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [(2S,4R,5R,5aR,6R,8R,9aR,10S,10aS)-2,5,10-triacetyloxy-4,8-dihydroxy-10a-(2-hydroxypropan-2-yl)-3,5a-dimethyl-9-methylidene-2,4,5,6,7,8,9a,10-octahydro-1H-benzo[f]azulen-6-yl] acetate |
| SMILES | C=C1[C@H](O)C[C@@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)[C@H](O)C3=C(C)[C@@H](OC(C)=O)C[C@@]3(C(C)(C)O)[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C28H40O11/c1-12-18(33)10-20(37-15(4)30)27(9)22(12)24(38-16(5)31)28(26(7,8)35)11-19(36-14(3)29)13(2)21(28)23(34)25(27)39-17(6)32/h18-20,22-25,33-35H,1,10-11H2,2-9H3/t18-,19+,20-,22+,23-,24+,25+,27+,28+/m1/s1 |
| InChIKey | KKYDBSIOPKKLQL-JEMKKXPGSA-N |
| XLogP | 1.51 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|