C40H46O13 — CID 162992072
[5,9,16-triacetyloxy-2-benzoyloxy-8-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] benzoate (PubChem CID 162992072) has the molecular formula C40H46O13 and a molecular weight of 734.80 g/mol. Its IUPAC name is [5,9,16-triacetyloxy-2-benzoyloxy-8-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] benzoate.
| Compound Name | [5,9,16-triacetyloxy-2-benzoyloxy-8-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] benzoate |
|---|---|
| PubChem CID | 162992072 |
| Molecular Formula | C40H46O13 |
| Molecular Weight | 734.80 g/mol |
| Exact Mass | 734.29 |
| IUPAC Name | [5,9,16-triacetyloxy-2-benzoyloxy-8-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] benzoate |
| SMILES | CC(=O)OC1CC2(C(C)(C)O)C(=C1C)C(O)C(OC(C)=O)C1(C)C(OC(=O)c3ccccc3)CC3OCC3(OC(C)=O)C1C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H46O13/c1-21-27(49-22(2)41)19-39(37(5,6)47)30(21)31(44)33(50-23(3)42)38(7)28(51-35(45)25-14-10-8-11-15-25)18-29-40(20-48-29,53-24(4)43)32(38)34(39)52-36(46)26-16-12-9-13-17-26/h8-17,27-29,31-34,44,47H,18-20H2,1-7H3 |
| InChIKey | CIBPUQCKJURRRK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|