C37H46O14 — CID 23250011
[(1S,2S,4S,7R,8R,9S,10S,12S,13S,16R)-4,7,8,10,12-pentaacetyloxy-2-(2-hydroxypropan-2-yl)-5,9-dimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadec-5-en-13-yl] benzoate (PubChem CID 23250011) has the molecular formula C37H46O14 and a molecular weight of 714.76 g/mol. Its IUPAC name is [(1S,2S,4S,7R,8R,9S,10S,12S,13S,16R)-4,7,8,10,12-pentaacetyloxy-2-(2-hydroxypropan-2-yl)-5,9-dimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadec-5-en-13-yl] benzoate.
| Compound Name | [(1S,2S,4S,7R,8R,9S,10S,12S,13S,16R)-4,7,8,10,12-pentaacetyloxy-2-(2-hydroxypropan-2-yl)-5,9-dimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadec-5-en-13-yl] benzoate |
|---|---|
| PubChem CID | 23250011 |
| Molecular Formula | C37H46O14 |
| Molecular Weight | 714.76 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | [(1S,2S,4S,7R,8R,9S,10S,12S,13S,16R)-4,7,8,10,12-pentaacetyloxy-2-(2-hydroxypropan-2-yl)-5,9-dimethyl-15-oxatetracyclo[7.6.1.02,6.013,16]hexadec-5-en-13-yl] benzoate |
| SMILES | CC(=O)O[C@H]1C[C@]2(C(C)(C)O)C(=C1C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]1(C)[C@@H](OC(C)=O)C[C@H](OC(C)=O)[C@@]3(OC(=O)c4ccccc4)CO[C@H]2[C@H]31 |
| InChI | InChI=1S/C37H46O14/c1-18-25(46-19(2)38)16-36(34(7,8)44)28(18)29(49-22(5)41)31(50-23(6)42)35(9)26(47-20(3)39)15-27(48-21(4)40)37(17-45-32(36)30(35)37)51-33(43)24-13-11-10-12-14-24/h10-14,25-27,29-32,44H,15-17H2,1-9H3/t25-,26-,27-,29+,30-,31-,32-,35+,36-,37-/m0/s1 |
| InChIKey | YWORNRDSVJJTHY-KBSYMDHASA-N |
| XLogP | 3.16 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|