C30H42O13 — CID 162865456
[(1R,2S,3S,5S,8R,9S,10S,11S,13R,16S)-2,8,9,16-tetraacetyloxy-5-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] acetate (PubChem CID 162865456) has the molecular formula C30H42O13 and a molecular weight of 610.65 g/mol. Its IUPAC name is [(1R,2S,3S,5S,8R,9S,10S,11S,13R,16S)-2,8,9,16-tetraacetyloxy-5-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] acetate.
| Compound Name | [(1R,2S,3S,5S,8R,9S,10S,11S,13R,16S)-2,8,9,16-tetraacetyloxy-5-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] acetate |
|---|---|
| PubChem CID | 162865456 |
| Molecular Formula | C30H42O13 |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | [(1R,2S,3S,5S,8R,9S,10S,11S,13R,16S)-2,8,9,16-tetraacetyloxy-5-hydroxy-3-(2-hydroxypropan-2-yl)-6,10-dimethyl-14-oxatetracyclo[8.6.0.03,7.013,16]hexadec-6-en-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2=C(C)[C@@H](O)C[C@@]2(C(C)(C)O)[C@@H](OC(C)=O)[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@H](OC(C)=O)[C@@]2(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H42O13/c1-13-19(36)11-29(27(7,8)37)22(13)23(40-15(3)32)25(41-16(4)33)28(9)20(39-14(2)31)10-21-30(12-38-21,43-18(6)35)24(28)26(29)42-17(5)34/h19-21,23-26,36-37H,10-12H2,1-9H3/t19-,20-,21+,23+,24-,25+,26-,28+,29-,30-/m0/s1 |
| InChIKey | TZFNSITZSZGMKW-OTYXFYDBSA-N |
| XLogP | 1.29 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|