C30H42O11 — CID 102533706
[(1R,2R,3R,4S,7R,9S,10S,11R,12R)-2,4,11,12-tetraacetyloxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] acetate (PubChem CID 102533706) has the molecular formula C30H42O11 and a molecular weight of 578.66 g/mol. Its IUPAC name is [(1R,2R,3R,4S,7R,9S,10S,11R,12R)-2,4,11,12-tetraacetyloxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] acetate.
| Compound Name | [(1R,2R,3R,4S,7R,9S,10S,11R,12R)-2,4,11,12-tetraacetyloxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] acetate |
|---|---|
| PubChem CID | 102533706 |
| Molecular Formula | C30H42O11 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [(1R,2R,3R,4S,7R,9S,10S,11R,12R)-2,4,11,12-tetraacetyloxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@H](OC(C)=O)[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C2=C(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C30H42O11/c1-14-10-11-20-24(38-16(3)32)26-29(9,21(37-15(2)31)12-22-30(26,13-36-22)41-19(6)35)27(40-18(5)34)25(39-17(4)33)23(14)28(20,7)8/h20-22,24-27H,10-13H2,1-9H3/t20-,21-,22+,24+,25+,26-,27-,29+,30-/m0/s1 |
| InChIKey | NQBJAPURPTWVMF-XDRYQMDBSA-N |
| XLogP | 3.21 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|