C36H52O14 — CID 162862573
[(1S,2S,3S,4S,7R,9S,10S,11S,12R,15S)-4,9,11,12,15-pentaacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] hexanoate (PubChem CID 162862573) has the molecular formula C36H52O14 and a molecular weight of 708.80 g/mol. Its IUPAC name is [(1S,2S,3S,4S,7R,9S,10S,11S,12R,15S)-4,9,11,12,15-pentaacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] hexanoate.
| Compound Name | [(1S,2S,3S,4S,7R,9S,10S,11S,12R,15S)-4,9,11,12,15-pentaacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] hexanoate |
|---|---|
| PubChem CID | 162862573 |
| Molecular Formula | C36H52O14 |
| Molecular Weight | 708.80 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | [(1S,2S,3S,4S,7R,9S,10S,11S,12R,15S)-4,9,11,12,15-pentaacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1[C@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@H](OC(C)=O)[C@@]2(C)[C@H](OC(C)=O)[C@H](OC(C)=O)C2=C(C)[C@@H](OC(C)=O)C[C@]1(O)C2(C)C |
| InChI | InChI=1S/C36H52O14/c1-11-12-13-14-27(42)49-32-30-34(10,25(46-20(4)38)15-26-35(30,17-44-26)50-23(7)41)31(48-22(6)40)29(47-21(5)39)28-18(2)24(45-19(3)37)16-36(32,43)33(28,8)9/h24-26,29-32,43H,11-17H2,1-10H3/t24-,25-,26+,29+,30+,31+,32-,34+,35-,36+/m0/s1 |
| InChIKey | XBVXASYQLGSARL-UCNNRLOZSA-N |
| XLogP | 3.42 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|