C32H42O13 — CID 46183147
[(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] (E)-but-2-enoate (PubChem CID 46183147) has the molecular formula C32H42O13 and a molecular weight of 634.68 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] (E)-but-2-enoate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 46183147 |
| Molecular Formula | C32H42O13 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H]1[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@H](OC(C)=O)[C@@]2(C)C(=O)[C@H](OC(C)=O)C2=C(C)[C@@H](OC(C)=O)C[C@]1(O)C2(C)C |
| InChI | InChI=1S/C32H42O13/c1-10-11-23(37)44-28-26-30(9,21(42-17(4)34)12-22-31(26,14-40-22)45-19(6)36)27(38)25(43-18(5)35)24-15(2)20(41-16(3)33)13-32(28,39)29(24,7)8/h10-11,20-22,25-26,28,39H,12-14H2,1-9H3/b11-10+/t20-,21-,22+,25+,26-,28-,30+,31-,32+/m0/s1 |
| InChIKey | FATREORVCGLBFQ-WZZRTNGVSA-N |
| XLogP | 2.06 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|