C32H44N2O15 — CID 59117730
[(10S)-2,4,12-triacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-9-nitrosooxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxybutanoate (PubChem CID 59117730) has the molecular formula C32H44N2O15 and a molecular weight of 696.70 g/mol. Its IUPAC name is [(10S)-2,4,12-triacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-9-nitrosooxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxybutanoate.
| Compound Name | [(10S)-2,4,12-triacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-9-nitrosooxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxybutanoate |
|---|---|
| PubChem CID | 59117730 |
| Molecular Formula | C32H44N2O15 |
| Molecular Weight | 696.70 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | [(10S)-2,4,12-triacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-9-nitrosooxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxybutanoate |
| SMILES | CC(=O)NC(C)C(O)C(=O)OC1CC2(O)C(OC(C)=O)C3C4(OC(C)=O)COC4CC(ON=O)[C@@]3(C)C(=O)C(OC(C)=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C32H44N2O15/c1-13-19(47-28(41)23(39)14(2)33-15(3)35)11-32(42)27(46-17(5)37)25-30(9,26(40)24(45-16(4)36)22(13)29(32,7)8)20(49-34-43)10-21-31(25,12-44-21)48-18(6)38/h14,19-21,23-25,27,39,42H,10-12H2,1-9H3,(H,33,35)/t14?,19?,20?,21?,23?,24?,25?,27?,30-,31?,32?/m1/s1 |
| InChIKey | QLQXFSKEFWOKRX-PFDWIHBSSA-N |
| XLogP | 0.50 |
| TPSA | 239.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.70 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|