C35H41FO13 — CID 46182902
[(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] 2-fluorobenzoate (PubChem CID 46182902) has the molecular formula C35H41FO13 and a molecular weight of 688.70 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] 2-fluorobenzoate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 46182902 |
| Molecular Formula | C35H41FO13 |
| Molecular Weight | 688.70 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,9,12,15-tetraacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] 2-fluorobenzoate |
| SMILES | CC(=O)O[C@H]1C(=O)[C@]2(C)[C@@H](OC(C)=O)C[C@H]3OC[C@@]3(OC(C)=O)[C@H]2[C@H](OC(=O)c2ccccc2F)[C@]2(O)C[C@H](OC(C)=O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C35H41FO13/c1-16-23(45-17(2)37)14-35(43)30(48-31(42)21-11-9-10-12-22(21)36)28-33(8,29(41)27(47-19(4)39)26(16)32(35,6)7)24(46-18(3)38)13-25-34(28,15-44-25)49-20(5)40/h9-12,23-25,27-28,30,43H,13-15H2,1-8H3/t23-,24-,25+,27+,28-,30-,33+,34-,35+/m0/s1 |
| InChIKey | ZUBDYWQLISMXNJ-NIWDXWTNSA-N |
| XLogP | 2.93 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|