C25H38O9 — CID 158019174
[(4S,10S)-1,15-dihydroxy-2,9,12-trimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate (PubChem CID 158019174) has the molecular formula C25H38O9 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(4S,10S)-1,15-dihydroxy-2,9,12-trimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate.
| Compound Name | [(4S,10S)-1,15-dihydroxy-2,9,12-trimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
|---|---|
| PubChem CID | 158019174 |
| Molecular Formula | C25H38O9 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [(4S,10S)-1,15-dihydroxy-2,9,12-trimethoxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
| SMILES | COC1C(=O)[C@]2(C)C(OC)CC3OC[C@@]3(OC(C)=O)C2C(OC)C2(O)CC(O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C25H38O9/c1-12-14(27)10-25(29)21(32-8)19-23(5,20(28)18(31-7)17(12)22(25,3)4)15(30-6)9-16-24(19,11-33-16)34-13(2)26/h14-16,18-19,21,27,29H,9-11H2,1-8H3/t14?,15?,16?,18?,19?,21?,23-,24+,25?/m1/s1 |
| InChIKey | GYQRWHBEYARXKP-MIXKIYHPSA-N |
| XLogP | 1.18 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|