C24H34O10 — CID 59914809
[(1S,2S,3R,4S,7R,9S,10S,12R)-4-acetyloxy-1,9,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate (PubChem CID 59914809) has the molecular formula C24H34O10 and a molecular weight of 482.53 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,12R)-4-acetyloxy-1,9,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,12R)-4-acetyloxy-1,9,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
|---|---|
| PubChem CID | 59914809 |
| Molecular Formula | C24H34O10 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R)-4-acetyloxy-1,9,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2[C@]3(OC(C)=O)CO[C@@H]3C[C@H](O)[C@@]2(C)C(=O)[C@H](O)C2=C(C)C(O)C[C@]1(O)C2(C)C |
| InChI | InChI=1S/C24H34O10/c1-10-13(27)8-24(31)20(33-11(2)25)18-22(6,19(30)17(29)16(10)21(24,4)5)14(28)7-15-23(18,9-32-15)34-12(3)26/h13-15,17-18,20,27-29,31H,7-9H2,1-6H3/t13?,14-,15+,17+,18-,20-,22+,23-,24+/m0/s1 |
| InChIKey | HXXKYSNOFJUTKP-FJACOLEESA-N |
| XLogP | -0.21 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|