C23H36AcO7 — CID 159271603
actinium;(4S,10S)-1,4,15-trihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 159271603) has the molecular formula C23H36AcO7 and a molecular weight of 651.53 g/mol. Its IUPAC name is actinium;(4S,10S)-1,4,15-trihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | actinium;(4S,10S)-1,4,15-trihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 159271603 |
| Molecular Formula | C23H36AcO7 |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | actinium;(4S,10S)-1,4,15-trihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | COC1C(=O)[C@]2(C)C(OC)CC3OC[C@@]3(O)C2C(C)C2(O)CC(O)C(C)=C1C2(C)C.[Ac] |
| InChI | InChI=1S/C23H36O7.Ac/c1-11-13(24)9-23(27)12(2)18-21(5,14(28-6)8-15-22(18,26)10-30-15)19(25)17(29-7)16(11)20(23,3)4;/h12-15,17-18,24,26-27H,8-10H2,1-7H3;/t12?,13?,14?,15?,17?,18?,21-,22+,23?;/m1./s1 |
| InChIKey | IQKWVGVVYIDPNB-SYEFQXILSA-N |
| XLogP | 1.23 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|