C23H36O6 — CID 59040416
(1R,4S,7R,9S,10R,12R,15S)-1,4,12-trihydroxy-15-methoxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 59040416) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is (1R,4S,7R,9S,10R,12R,15S)-1,4,12-trihydroxy-15-methoxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1R,4S,7R,9S,10R,12R,15S)-1,4,12-trihydroxy-15-methoxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 59040416 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (1R,4S,7R,9S,10R,12R,15S)-1,4,12-trihydroxy-15-methoxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CO[C@H]1C[C@@]2(O)C(C)C3[C@]4(O)CO[C@@H]4C[C@H](C)[C@@]3(C)C(=O)[C@H](O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C23H36O6/c1-11-8-15-22(26,10-29-15)18-13(3)23(27)9-14(28-7)12(2)16(20(23,4)5)17(24)19(25)21(11,18)6/h11,13-15,17-18,24,26-27H,8-10H2,1-7H3/t11-,13?,14-,15+,17+,18?,21+,22-,23+/m0/s1 |
| InChIKey | YZKSCVMDXPNZIC-DMLRKTEGSA-N |
| XLogP | 1.85 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|