C31H42O9 — CID 161152748
[(4S,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate (PubChem CID 161152748) has the molecular formula C31H42O9 and a molecular weight of 558.67 g/mol. Its IUPAC name is [(4S,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate.
| Compound Name | [(4S,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 161152748 |
| Molecular Formula | C31H42O9 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | [(4S,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(O)CC4OC[C@@]4(O)C3C(C)C(O)(CC1OC(=O)C(O)[C@@H](C)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C31H42O9/c1-15(18-10-8-7-9-11-18)23(33)27(36)40-19-13-31(38)17(3)25-29(6,20(32)12-21-30(25,37)14-39-21)26(35)24(34)22(16(19)2)28(31,4)5/h7-11,15,17,19-21,23-25,32-34,37-38H,12-14H2,1-6H3/t15-,17?,19?,20?,21?,23?,24?,25?,29+,30-,31?/m0/s1 |
| InChIKey | UIKYNJKJLREQJX-VECQJQKUSA-N |
| XLogP | 1.64 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|