C33H43AcNO12 — CID 159842111
[(4S,10S)-2-acetyloxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate;actinium (PubChem CID 159842111) has the molecular formula C33H43AcNO12 and a molecular weight of 872.70 g/mol. Its IUPAC name is [(4S,10S)-2-acetyloxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate;actinium.
| Compound Name | [(4S,10S)-2-acetyloxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate;actinium |
|---|---|
| PubChem CID | 159842111 |
| Molecular Formula | C33H43AcNO12 |
| Molecular Weight | 872.70 g/mol |
| Exact Mass | 872.31 |
| IUPAC Name | [(4S,10S)-2-acetyloxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate;actinium |
| SMILES | CC(=O)NC(c1ccccc1)C(O)C(=O)OC1CC2(O)C(OC(C)=O)C3[C@]4(O)COC4CC(O)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C.[Ac] |
| InChI | InChI=1S/C33H43NO12.Ac/c1-15-19(46-29(41)25(39)23(34-16(2)35)18-10-8-7-9-11-18)13-33(43)28(45-17(3)36)26-31(6,20(37)12-21-32(26,42)14-44-21)27(40)24(38)22(15)30(33,4)5;/h7-11,19-21,23-26,28,37-39,42-43H,12-14H2,1-6H3,(H,34,35);/t19?,20?,21?,23?,24?,25?,26?,28?,31-,32+,33?;/m1./s1 |
| InChIKey | HPKFKIPRAXOFPN-SNDYHWMYSA-N |
| XLogP | 0.01 |
| TPSA | 209.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.70 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|