C36H47NO12 — CID 158305559
[(4S,10S)-15-(3-acetamido-2-hydroxy-5-methylhex-4-enoyl)oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 158305559) has the molecular formula C36H47NO12 and a molecular weight of 685.77 g/mol. Its IUPAC name is [(4S,10S)-15-(3-acetamido-2-hydroxy-5-methylhex-4-enoyl)oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(4S,10S)-15-(3-acetamido-2-hydroxy-5-methylhex-4-enoyl)oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 158305559 |
| Molecular Formula | C36H47NO12 |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.31 |
| IUPAC Name | [(4S,10S)-15-(3-acetamido-2-hydroxy-5-methylhex-4-enoyl)oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)NC(C=C(C)C)C(O)C(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3[C@]4(O)COC4CC(O)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C36H47NO12/c1-17(2)13-21(37-19(4)38)26(40)32(44)48-22-15-36(46)30(49-31(43)20-11-9-8-10-12-20)28-34(7,23(39)14-24-35(28,45)16-47-24)29(42)27(41)25(18(22)3)33(36,5)6/h8-13,21-24,26-28,30,39-41,45-46H,14-16H2,1-7H3,(H,37,38)/t21?,22?,23?,24?,26?,27?,28?,30?,34-,35+,36?/m1/s1 |
| InChIKey | NAQFLERPRQZVTD-RBQYLHPOSA-N |
| XLogP | 0.89 |
| TPSA | 209.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|