C44H49NO11 — CID 59911563
[(10S)-15-[(2R)-3-benzamido-2-methyl-3-phenylpropanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 59911563) has the molecular formula C44H49NO11 and a molecular weight of 767.87 g/mol. Its IUPAC name is [(10S)-15-[(2R)-3-benzamido-2-methyl-3-phenylpropanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(10S)-15-[(2R)-3-benzamido-2-methyl-3-phenylpropanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59911563 |
| Molecular Formula | C44H49NO11 |
| Molecular Weight | 767.87 g/mol |
| Exact Mass | 767.33 |
| IUPAC Name | [(10S)-15-[(2R)-3-benzamido-2-methyl-3-phenylpropanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(O)CC4OCC4(O)C3C(OC(=O)c3ccccc3)C(O)(CC1OC(=O)[C@H](C)C(NC(=O)c1ccccc1)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C44H49NO11/c1-24-29(55-39(50)25(2)33(26-15-9-6-10-16-26)45-38(49)27-17-11-7-12-18-27)22-44(53)37(56-40(51)28-19-13-8-14-20-28)35-42(5,30(46)21-31-43(35,52)23-54-31)36(48)34(47)32(24)41(44,3)4/h6-20,25,29-31,33-35,37,46-47,52-53H,21-23H2,1-5H3,(H,45,49)/t25-,29?,30?,31?,33?,34?,35?,37?,42-,43?,44?/m1/s1 |
| InChIKey | WPOATHCACQCLHB-QCGDSOGASA-N |
| XLogP | 3.87 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|